C19H29N3O2 — CID 56886642
(4aS,8aR)-1-(2-aminoethyl)-6-(2-phenylethyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid (PubChem CID 56886642) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (4aS,8aR)-1-(2-aminoethyl)-6-(2-phenylethyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aR)-1-(2-aminoethyl)-6-(2-phenylethyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 56886642 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (4aS,8aR)-1-(2-aminoethyl)-6-(2-phenylethyl)-3,4,5,7,8,8a-hexahydro-2H-1,6-naphthyridine-4a-carboxylic acid |
| SMILES | NCCN1CCC[C@]2(C(=O)O)CN(CCc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C19H29N3O2/c20-10-14-22-11-4-9-19(18(23)24)15-21(13-8-17(19)22)12-7-16-5-2-1-3-6-16/h1-3,5-6,17H,4,7-15,20H2,(H,23,24)/t17-,19+/m1/s1 |
| InChIKey | YRVSYZSKXMAPBJ-MJGOQNOKSA-N |
| XLogP | 1.43 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |