C21H25NO4 — CID 56926158
4-[(E)-3-(2,5-dimethylpyrrol-1-yl)-3-oxoprop-1-enoxy]-5-phenylmethoxypentanal (PubChem CID 56926158) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 4-[(E)-3-(2,5-dimethylpyrrol-1-yl)-3-oxoprop-1-enoxy]-5-phenylmethoxypentanal.
| Compound Name | 4-[(E)-3-(2,5-dimethylpyrrol-1-yl)-3-oxoprop-1-enoxy]-5-phenylmethoxypentanal |
|---|---|
| PubChem CID | 56926158 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 4-[(E)-3-(2,5-dimethylpyrrol-1-yl)-3-oxoprop-1-enoxy]-5-phenylmethoxypentanal |
| SMILES | Cc1ccc(C)n1C(=O)/C=C/OC(CCC=O)COCc1ccccc1 |
| InChI | InChI=1S/C21H25NO4/c1-17-10-11-18(2)22(17)21(24)12-14-26-20(9-6-13-23)16-25-15-19-7-4-3-5-8-19/h3-5,7-8,10-14,20H,6,9,15-16H2,1-2H3/b14-12+ |
| InChIKey | JDFKIRHYERTZIK-WYMLVPIESA-N |
| XLogP | 3.84 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|