C34H40ClN3O5 — CID 56955198
N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5-hydroxy-7-methoxy-4-oxochromene-2-carboxamide (PubChem CID 56955198) has the molecular formula C34H40ClN3O5 and a molecular weight of 606.16 g/mol. Its IUPAC name is N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5-hydroxy-7-methoxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5-hydroxy-7-methoxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 56955198 |
| Molecular Formula | C34H40ClN3O5 |
| Molecular Weight | 606.16 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | N-[10-[(6-chloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5-hydroxy-7-methoxy-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(O)c2c(=O)cc(C(=O)NCCCCCCCCCCNc3c4c(nc5cc(Cl)ccc35)CCCC4)oc2c1 |
| InChI | InChI=1S/C34H40ClN3O5/c1-42-23-19-28(39)32-29(40)21-31(43-30(32)20-23)34(41)37-17-11-7-5-3-2-4-6-10-16-36-33-24-12-8-9-13-26(24)38-27-18-22(35)14-15-25(27)33/h14-15,18-21,39H,2-13,16-17H2,1H3,(H,36,38)(H,37,41) |
| InChIKey | ZUULLQGMZOHIHX-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 113.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.16 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|