C35H41Cl2N3O5 — CID 56954988
N-[10-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide (PubChem CID 56954988) has the molecular formula C35H41Cl2N3O5 and a molecular weight of 654.64 g/mol. Its IUPAC name is N-[10-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide.
| Compound Name | N-[10-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 56954988 |
| Molecular Formula | C35H41Cl2N3O5 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 653.24 |
| IUPAC Name | N-[10-[(6,8-dichloro-1,2,3,4-tetrahydroacridin-9-yl)amino]decyl]-5,7-dimethoxy-4-oxochromene-2-carboxamide |
| SMILES | COc1cc(OC)c2c(=O)cc(C(=O)NCCCCCCCCCCNc3c4c(nc5cc(Cl)cc(Cl)c35)CCCC4)oc2c1 |
| InChI | InChI=1S/C35H41Cl2N3O5/c1-43-23-19-29(44-2)33-28(41)21-31(45-30(33)20-23)35(42)39-16-12-8-6-4-3-5-7-11-15-38-34-24-13-9-10-14-26(24)40-27-18-22(36)17-25(37)32(27)34/h17-21H,3-16H2,1-2H3,(H,38,40)(H,39,42) |
| InChIKey | ZBIJYSUQXYNZEQ-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|