C23H22F3N3O2 — CID 56967051
tert-butyl 5-methyl-2-[[2-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]amino]benzoate (PubChem CID 56967051) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is tert-butyl 5-methyl-2-[[2-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]amino]benzoate.
| Compound Name | tert-butyl 5-methyl-2-[[2-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]amino]benzoate |
|---|---|
| PubChem CID | 56967051 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | tert-butyl 5-methyl-2-[[2-[2-(trifluoromethyl)phenyl]pyrimidin-5-yl]amino]benzoate |
| SMILES | Cc1ccc(Nc2cnc(-c3ccccc3C(F)(F)F)nc2)c(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C23H22F3N3O2/c1-14-9-10-19(17(11-14)21(30)31-22(2,3)4)29-15-12-27-20(28-13-15)16-7-5-6-8-18(16)23(24,25)26/h5-13,29H,1-4H3 |
| InChIKey | RJOMYZGPLPTKNI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |