C18H13N3O5S — CID 56971524
3-methoxy-5-(2-nitrophenyl)sulfonylpyrido[3,2-b]indole (PubChem CID 56971524) has the molecular formula C18H13N3O5S and a molecular weight of 383.39 g/mol. Its IUPAC name is 3-methoxy-5-(2-nitrophenyl)sulfonylpyrido[3,2-b]indole.
| Compound Name | 3-methoxy-5-(2-nitrophenyl)sulfonylpyrido[3,2-b]indole |
|---|---|
| PubChem CID | 56971524 |
| Molecular Formula | C18H13N3O5S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 3-methoxy-5-(2-nitrophenyl)sulfonylpyrido[3,2-b]indole |
| SMILES | COc1cnc2c3ccccc3n(S(=O)(=O)c3ccccc3[N+](=O)[O-])c2c1 |
| InChI | InChI=1S/C18H13N3O5S/c1-26-12-10-16-18(19-11-12)13-6-2-3-7-14(13)20(16)27(24,25)17-9-5-4-8-15(17)21(22)23/h2-11H,1H3 |
| InChIKey | HIMPZOGLCCCGIG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|