C14H10N2O4S2 — CID 56973483
N-(3-amino-1,4-dioxonaphthalen-2-yl)thiophene-2-sulfonamide (PubChem CID 56973483) has the molecular formula C14H10N2O4S2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-(3-amino-1,4-dioxonaphthalen-2-yl)thiophene-2-sulfonamide.
| Compound Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 56973483 |
| Molecular Formula | C14H10N2O4S2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | N-(3-amino-1,4-dioxonaphthalen-2-yl)thiophene-2-sulfonamide |
| SMILES | NC1=C(NS(=O)(=O)c2cccs2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H10N2O4S2/c15-11-12(16-22(19,20)10-6-3-7-21-10)14(18)9-5-2-1-4-8(9)13(11)17/h1-7,16H,15H2 |
| InChIKey | NPCKKXBEDMGYHD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|