C33H54O4S2 — CID 56980554
5-[[(9S,10R,13S,14S)-1-(4,5-dihydroxy-4-methylpentyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpentane-1,2-diol (PubChem CID 56980554) has the molecular formula C33H54O4S2 and a molecular weight of 578.93 g/mol. Its IUPAC name is 5-[[(9S,10R,13S,14S)-1-(4,5-dihydroxy-4-methylpentyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpentane-1,2-diol.
| Compound Name | 5-[[(9S,10R,13S,14S)-1-(4,5-dihydroxy-4-methylpentyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpentane-1,2-diol |
|---|---|
| PubChem CID | 56980554 |
| Molecular Formula | C33H54O4S2 |
| Molecular Weight | 578.93 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 5-[[(9S,10R,13S,14S)-1-(4,5-dihydroxy-4-methylpentyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylpentane-1,2-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCCCC(C)(O)CO)CC(SCCCC(C)(O)CO)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C33H54O4S2/c1-6-23-10-12-27-26-11-9-24-19-25(38-17-7-14-30(2,36)21-34)20-29(39-18-8-15-31(3,37)22-35)33(24,5)28(26)13-16-32(23,27)4/h9-11,25,27-29,34-37H,6-8,12-22H2,1-5H3/t25?,27-,28-,29?,30?,31?,32+,33-/m0/s1 |
| InChIKey | DYPCMIYKWGSFHO-VCDCOVIOSA-N |
| XLogP | 6.68 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.93 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|