C31H50O4S2 — CID 57121327
4-[[(9S,10R,13S,14S)-1-(3,4-dihydroxy-3-methylbutyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol (PubChem CID 57121327) has the molecular formula C31H50O4S2 and a molecular weight of 550.87 g/mol. Its IUPAC name is 4-[[(9S,10R,13S,14S)-1-(3,4-dihydroxy-3-methylbutyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol.
| Compound Name | 4-[[(9S,10R,13S,14S)-1-(3,4-dihydroxy-3-methylbutyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol |
|---|---|
| PubChem CID | 57121327 |
| Molecular Formula | C31H50O4S2 |
| Molecular Weight | 550.87 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | 4-[[(9S,10R,13S,14S)-1-(3,4-dihydroxy-3-methylbutyl)sulfanyl-17-ethyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]-2-methylbutane-1,2-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCCC(C)(O)CO)CC(SCCC(C)(O)CO)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H50O4S2/c1-6-21-8-10-25-24-9-7-22-17-23(36-15-13-28(2,34)19-32)18-27(37-16-14-29(3,35)20-33)31(22,5)26(24)11-12-30(21,25)4/h7-9,23,25-27,32-35H,6,10-20H2,1-5H3/t23?,25-,26-,27?,28?,29?,30+,31-/m0/s1 |
| InChIKey | CUWPWDAMJGQNCB-XAMBDGSWSA-N |
| XLogP | 5.90 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.87 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|