C35H58O4S2 — CID 57110302
3-ethyl-5-[[(9S,10R,13S,14S)-17-ethyl-1-(3-ethyl-3,5-dihydroxypentyl)sulfanyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]pentane-1,3-diol (PubChem CID 57110302) has the molecular formula C35H58O4S2 and a molecular weight of 606.98 g/mol. Its IUPAC name is 3-ethyl-5-[[(9S,10R,13S,14S)-17-ethyl-1-(3-ethyl-3,5-dihydroxypentyl)sulfanyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]pentane-1,3-diol.
| Compound Name | 3-ethyl-5-[[(9S,10R,13S,14S)-17-ethyl-1-(3-ethyl-3,5-dihydroxypentyl)sulfanyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]pentane-1,3-diol |
|---|---|
| PubChem CID | 57110302 |
| Molecular Formula | C35H58O4S2 |
| Molecular Weight | 606.98 g/mol |
| Exact Mass | 606.38 |
| IUPAC Name | 3-ethyl-5-[[(9S,10R,13S,14S)-17-ethyl-1-(3-ethyl-3,5-dihydroxypentyl)sulfanyl-10,13-dimethyl-2,3,4,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-3-yl]sulfanyl]pentane-1,3-diol |
| SMILES | CCC1=CC[C@H]2C3=CC=C4CC(SCCC(O)(CC)CCO)CC(SCCC(O)(CC)CCO)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C35H58O4S2/c1-6-25-10-12-29-28-11-9-26-23-27(40-21-17-34(38,7-2)15-19-36)24-31(41-22-18-35(39,8-3)16-20-37)33(26,5)30(28)13-14-32(25,29)4/h9-11,27,29-31,36-39H,6-8,12-24H2,1-5H3/t27?,29-,30-,31?,32+,33-,34?,35?/m0/s1 |
| InChIKey | GIWPLBMYJXXCIV-CAVKISRYSA-N |
| XLogP | 7.46 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.98 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|