C31H55N3O7 — CID 56989088
tert-butyl (2S)-1-[(2R)-6-amino-2-(5-heptyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 56989088) has the molecular formula C31H55N3O7 and a molecular weight of 581.80 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-6-amino-2-(5-heptyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-heptyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 56989088 |
| Molecular Formula | C31H55N3O7 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.40 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-heptyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCCCCC1CC([C@@](CCCCN)(NC(=O)OC(C)(C)C)C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C31H55N3O7/c1-8-9-10-11-12-16-22-21-23(25(35)39-22)31(18-13-14-19-32,33-28(38)41-30(5,6)7)27(37)34-20-15-17-24(34)26(36)40-29(2,3)4/h22-24H,8-21,32H2,1-7H3,(H,33,38)/t22?,23?,24-,31+/m0/s1 |
| InChIKey | DSCMHXRQBWDDQV-DPCOMJDUSA-N |
| XLogP | 5.00 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|