C28H49N3O7 — CID 57315439
tert-butyl (2S)-1-[(2R)-6-amino-2-(5-butyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 57315439) has the molecular formula C28H49N3O7 and a molecular weight of 539.71 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-6-amino-2-(5-butyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-butyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57315439 |
| Molecular Formula | C28H49N3O7 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-butyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CCCCC1CC([C@@](CCCCN)(NC(=O)OC(C)(C)C)C(=O)N2CCC[C@H]2C(=O)OC(C)(C)C)C(=O)O1 |
| InChI | InChI=1S/C28H49N3O7/c1-8-9-13-19-18-20(22(32)36-19)28(15-10-11-16-29,30-25(35)38-27(5,6)7)24(34)31-17-12-14-21(31)23(33)37-26(2,3)4/h19-21H,8-18,29H2,1-7H3,(H,30,35)/t19?,20?,21-,28+/m0/s1 |
| InChIKey | XQUISCNOIDKEOZ-BUXGHKSGSA-N |
| XLogP | 3.83 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|