C30H51N3O7 — CID 57137675
tert-butyl (2S)-1-[(2R)-6-amino-2-(5-cyclohexyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate (PubChem CID 57137675) has the molecular formula C30H51N3O7 and a molecular weight of 565.75 g/mol. Its IUPAC name is tert-butyl (2S)-1-[(2R)-6-amino-2-(5-cyclohexyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-cyclohexyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57137675 |
| Molecular Formula | C30H51N3O7 |
| Molecular Weight | 565.75 g/mol |
| Exact Mass | 565.37 |
| IUPAC Name | tert-butyl (2S)-1-[(2R)-6-amino-2-(5-cyclohexyl-2-oxooxolan-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N[C@@](CCCCN)(C(=O)N1CCC[C@H]1C(=O)OC(C)(C)C)C1CC(C2CCCCC2)OC1=O |
| InChI | InChI=1S/C30H51N3O7/c1-28(2,3)39-25(35)22-15-12-18-33(22)26(36)30(16-10-11-17-31,32-27(37)40-29(4,5)6)21-19-23(38-24(21)34)20-13-8-7-9-14-20/h20-23H,7-19,31H2,1-6H3,(H,32,37)/t21?,22-,23?,30+/m0/s1 |
| InChIKey | VPIRXOKYYNFSHY-RFIRMNTFSA-N |
| XLogP | 4.22 |
| TPSA | 137.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.75 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|