About tetrachloro(diphenyl)-λ6-sulfane
tetrachloro(diphenyl)-λ6-sulfane (PubChem CID 56994351) has the molecular formula C12H10Cl4S
and a molecular weight of 328.09 g/mol. Its IUPAC name is tetrachloro(diphenyl)-λ6-sulfane.
Molecular Properties
| Compound Name | tetrachloro(diphenyl)-λ6-sulfane |
| PubChem CID | 56994351 |
| Molecular Formula | C12H10Cl4S |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | tetrachloro(diphenyl)-λ6-sulfane |
| SMILES | ClS(Cl)(Cl)(Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10Cl4S/c13-17(14,15,16,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | ZNJNESKPGZCCHX-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze tetrachloro(diphenyl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrachloro(diphenyl)-λ6-sulfane?
The IUPAC name of tetrachloro(diphenyl)-λ6-sulfane (CID 56994351) is tetrachloro(diphenyl)-λ6-sulfane.
What is the SMILES notation for tetrachloro(diphenyl)-λ6-sulfane?
The canonical SMILES for tetrachloro(diphenyl)-λ6-sulfane is ClS(Cl)(Cl)(Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of tetrachloro(diphenyl)-λ6-sulfane?
The InChIKey is ZNJNESKPGZCCHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl4S/c13-17(14,15,16,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H.
What are the key properties of tetrachloro(diphenyl)-λ6-sulfane?
tetrachloro(diphenyl)-λ6-sulfane has a molecular weight of 328.09 g/mol, XLogP of 6.60, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrachloro(diphenyl)-λ6-sulfane is sourced from PubChem (CID 56994351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).