C30H45NO — CID 56995714
9-[4-[dodecan-4-yl(methyl)amino]phenyl]-2,7-dimethylnona-2,4,6,8-tetraenal (PubChem CID 56995714) has the molecular formula C30H45NO and a molecular weight of 435.70 g/mol. Its IUPAC name is 9-[4-[dodecan-4-yl(methyl)amino]phenyl]-2,7-dimethylnona-2,4,6,8-tetraenal.
| Compound Name | 9-[4-[dodecan-4-yl(methyl)amino]phenyl]-2,7-dimethylnona-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 56995714 |
| Molecular Formula | C30H45NO |
| Molecular Weight | 435.70 g/mol |
| Exact Mass | 435.35 |
| IUPAC Name | 9-[4-[dodecan-4-yl(methyl)amino]phenyl]-2,7-dimethylnona-2,4,6,8-tetraenal |
| SMILES | CCCCCCCCC(CCC)N(C)c1ccc(C=CC(C)=CC=CC=C(C)C=O)cc1 |
| InChI | InChI=1S/C30H45NO/c1-6-8-9-10-11-12-18-29(15-7-2)31(5)30-23-21-28(22-24-30)20-19-26(3)16-13-14-17-27(4)25-32/h13-14,16-17,19-25,29H,6-12,15,18H2,1-5H3 |
| InChIKey | VFSRTGGPFCECPW-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.70 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|