C14H26N2O4 — CID 57001204
(3S)-3-[[1-(2-aminopropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid (PubChem CID 57001204) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is (3S)-3-[[1-(2-aminopropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-(2-aminopropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57001204 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (3S)-3-[[1-(2-aminopropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid |
| SMILES | CC(N)COC1(N[C@H](C=O)CC(=O)O)C(C)CCC1C |
| InChI | InChI=1S/C14H26N2O4/c1-9-4-5-10(2)14(9,20-8-11(3)15)16-12(7-17)6-13(18)19/h7,9-12,16H,4-6,8,15H2,1-3H3,(H,18,19)/t9?,10?,11?,12-,14?/m0/s1 |
| InChIKey | YGWSRPVZSPALLJ-UYIBLKNYSA-N |
| XLogP | 0.74 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|