C16H28N2O3 — CID 173409661
(3R)-3-[[2-amino-4-(2,5-dimethylcyclopentyl)-2-methylbut-3-enyl]amino]-4-oxobutanoic acid (PubChem CID 173409661) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3R)-3-[[2-amino-4-(2,5-dimethylcyclopentyl)-2-methylbut-3-enyl]amino]-4-oxobutanoic acid.
| Compound Name | (3R)-3-[[2-amino-4-(2,5-dimethylcyclopentyl)-2-methylbut-3-enyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 173409661 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (3R)-3-[[2-amino-4-(2,5-dimethylcyclopentyl)-2-methylbut-3-enyl]amino]-4-oxobutanoic acid |
| SMILES | CC1CCC(C)C1C=CC(C)(N)CN[C@@H](C=O)CC(=O)O |
| InChI | InChI=1S/C16H28N2O3/c1-11-4-5-12(2)14(11)6-7-16(3,17)10-18-13(9-19)8-15(20)21/h6-7,9,11-14,18H,4-5,8,10,17H2,1-3H3,(H,20,21)/t11?,12?,13-,14?,16?/m1/s1 |
| InChIKey | WCUNBPOOXSOKGE-OVTHLXNDSA-N |
| XLogP | 1.57 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|