C17H32N2O4 — CID 88669652
(3R)-3-[[2-amino-4-(2-tert-butylcyclopentyl)-1-hydroxybutyl]amino]-4-oxobutanoic acid (PubChem CID 88669652) has the molecular formula C17H32N2O4 and a molecular weight of 328.45 g/mol. Its IUPAC name is (3R)-3-[[2-amino-4-(2-tert-butylcyclopentyl)-1-hydroxybutyl]amino]-4-oxobutanoic acid.
| Compound Name | (3R)-3-[[2-amino-4-(2-tert-butylcyclopentyl)-1-hydroxybutyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88669652 |
| Molecular Formula | C17H32N2O4 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (3R)-3-[[2-amino-4-(2-tert-butylcyclopentyl)-1-hydroxybutyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)C1CCCC1CCC(N)C(O)N[C@@H](C=O)CC(=O)O |
| InChI | InChI=1S/C17H32N2O4/c1-17(2,3)13-6-4-5-11(13)7-8-14(18)16(23)19-12(10-20)9-15(21)22/h10-14,16,19,23H,4-9,18H2,1-3H3,(H,21,22)/t11?,12-,13?,14?,16?/m1/s1 |
| InChIKey | ZQETYRGLBSSONC-ZLOJBABVSA-N |
| XLogP | 1.51 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|