C18H30N2O5 — CID 54123717
(3S)-3-amino-4-[[4-(2-tert-butylcyclopentyl)-1-methoxy-1-oxobut-2-en-2-yl]amino]-4-oxobutanoic acid (PubChem CID 54123717) has the molecular formula C18H30N2O5 and a molecular weight of 354.45 g/mol. Its IUPAC name is (3S)-3-amino-4-[[4-(2-tert-butylcyclopentyl)-1-methoxy-1-oxobut-2-en-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-[[4-(2-tert-butylcyclopentyl)-1-methoxy-1-oxobut-2-en-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54123717 |
| Molecular Formula | C18H30N2O5 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (3S)-3-amino-4-[[4-(2-tert-butylcyclopentyl)-1-methoxy-1-oxobut-2-en-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)C(=CCC1CCCC1C(C)(C)C)NC(=O)[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C18H30N2O5/c1-18(2,3)12-7-5-6-11(12)8-9-14(17(24)25-4)20-16(23)13(19)10-15(21)22/h9,11-13H,5-8,10,19H2,1-4H3,(H,20,23)(H,21,22)/t11?,12?,13-/m0/s1 |
| InChIKey | NPNCFMGEDUYLCO-BPCQOVAHSA-N |
| XLogP | 1.81 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|