C15H28N2O4 — CID 57322954
(3S)-3-[[1-(2-amino-2-methylpropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid (PubChem CID 57322954) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3S)-3-[[1-(2-amino-2-methylpropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[1-(2-amino-2-methylpropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57322954 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | (3S)-3-[[1-(2-amino-2-methylpropoxy)-2,5-dimethylcyclopentyl]amino]-4-oxobutanoic acid |
| SMILES | CC1CCC(C)C1(N[C@H](C=O)CC(=O)O)OCC(C)(C)N |
| InChI | InChI=1S/C15H28N2O4/c1-10-5-6-11(2)15(10,21-9-14(3,4)16)17-12(8-18)7-13(19)20/h8,10-12,17H,5-7,9,16H2,1-4H3,(H,19,20)/t10?,11?,12-,15?/m0/s1 |
| InChIKey | BSNSZVYNTOFYRD-WAQQSHLVSA-N |
| XLogP | 1.13 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|