C16H26N2O3 — CID 57322427
(3S)-3-[[2-amino-2-[2-(2,5-dimethylcyclopentyl)ethenyl]cyclopropyl]amino]-4-oxobutanoic acid (PubChem CID 57322427) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is (3S)-3-[[2-amino-2-[2-(2,5-dimethylcyclopentyl)ethenyl]cyclopropyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-amino-2-[2-(2,5-dimethylcyclopentyl)ethenyl]cyclopropyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57322427 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3S)-3-[[2-amino-2-[2-(2,5-dimethylcyclopentyl)ethenyl]cyclopropyl]amino]-4-oxobutanoic acid |
| SMILES | CC1CCC(C)C1C=CC1(N)CC1N[C@H](C=O)CC(=O)O |
| InChI | InChI=1S/C16H26N2O3/c1-10-3-4-11(2)13(10)5-6-16(17)8-14(16)18-12(9-19)7-15(20)21/h5-6,9-14,18H,3-4,7-8,17H2,1-2H3,(H,20,21)/t10?,11?,12-,13?,14?,16?/m0/s1 |
| InChIKey | ZPQWZZLMHXESLJ-KKYIZUHJSA-N |
| XLogP | 1.33 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|