C21H25F3O3 — CID 57003454
[(8R,9R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate (PubChem CID 57003454) has the molecular formula C21H25F3O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is [(8R,9R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(8R,9R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57003454 |
| Molecular Formula | C21H25F3O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | [(8R,9R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,16-decahydrocyclopenta[a]phenanthren-3-yl] 2,2,2-trifluoroacetate |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CC=C4CC(OC(=O)C(F)(F)F)CC[C@@]43C)C1=CCC2=O |
| InChI | InChI=1S/C21H25F3O3/c1-19-9-7-13(27-18(26)21(22,23)24)11-12(19)3-4-14-15-5-6-17(25)20(15,2)10-8-16(14)19/h3,5,13-14,16H,4,6-11H2,1-2H3/t13?,14-,16+,19-,20-/m0/s1 |
| InChIKey | HNNSLKMYNQNJIC-IFOUVORSSA-N |
| XLogP | 4.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|