C24H31NO5 — CID 57005616
1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]pyrrole-2,5-dione (PubChem CID 57005616) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57005616 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]pyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC2CC3CC(C2C)C3(C)C)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C24H31NO5/c1-15-18-13-17(24(18,2)3)14-20(15)30-29-19-9-5-7-16(8-6-12-28-4)23(19)25-21(26)10-11-22(25)27/h5,7,9-11,15,17-18,20H,6,8,12-14H2,1-4H3 |
| InChIKey | JRTDQWJTWDAHJQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|