C25H29NO5 — CID 57085144
1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 57085144) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57085144 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC(C)(C)c2ccccc2)c1N1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C25H29NO5/c1-17-18(2)24(28)26(23(17)27)22-19(12-10-16-29-5)11-9-15-21(22)30-31-25(3,4)20-13-7-6-8-14-20/h6-9,11,13-15H,10,12,16H2,1-5H3 |
| InChIKey | RVIKCWJQJJBDGR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|