C24H27NO5 — CID 57147845
1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3-methylpyrrole-2,5-dione (PubChem CID 57147845) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57147845 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]-3-methylpyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC(C)(C)c2ccccc2)c1N1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C24H27NO5/c1-17-16-21(26)25(23(17)27)22-18(11-9-15-28-4)10-8-14-20(22)29-30-24(2,3)19-12-6-5-7-13-19/h5-8,10,12-14,16H,9,11,15H2,1-4H3 |
| InChIKey | OZGLPSBFFNFUCL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|