C26H35NO5 — CID 57124258
1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 57124258) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57124258 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC2CC3CC(C2C)C3(C)C)c1N1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C26H35NO5/c1-15-16(2)25(29)27(24(15)28)23-18(10-8-12-30-6)9-7-11-21(23)31-32-22-14-19-13-20(17(22)3)26(19,4)5/h7,9,11,17,19-20,22H,8,10,12-14H2,1-6H3 |
| InChIKey | YTZNJSMRESOWQT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|