C25H33NO5 — CID 57282796
1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3-methylpyrrole-2,5-dione (PubChem CID 57282796) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 57282796 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-[(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl)peroxy]phenyl]-3-methylpyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC2CC3CC(C2C)C3(C)C)c1N1C(=O)C=C(C)C1=O |
| InChI | InChI=1S/C25H33NO5/c1-15-12-22(27)26(24(15)28)23-17(9-7-11-29-5)8-6-10-20(23)30-31-21-14-18-13-19(16(21)2)25(18,3)4/h6,8,10,12,16,18-19,21H,7,9,11,13-14H2,1-5H3 |
| InChIKey | JUOBTWAJJGPOGM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|