C23H25NO5 — CID 57041344
1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]pyrrole-2,5-dione (PubChem CID 57041344) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 57041344 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-[2-(3-methoxypropyl)-6-(2-phenylpropan-2-ylperoxy)phenyl]pyrrole-2,5-dione |
| SMILES | COCCCc1cccc(OOC(C)(C)c2ccccc2)c1N1C(=O)C=CC1=O |
| InChI | InChI=1S/C23H25NO5/c1-23(2,18-11-5-4-6-12-18)29-28-19-13-7-9-17(10-8-16-27-3)22(19)24-20(25)14-15-21(24)26/h4-7,9,11-15H,8,10,16H2,1-3H3 |
| InChIKey | UFUBDJZDZKSFML-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|