C24H29N3O5 — CID 57017416
7-[2-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)benzotriazol-5-yl]oxy-7-hydroxyhept-2-en-4-one (PubChem CID 57017416) has the molecular formula C24H29N3O5 and a molecular weight of 439.51 g/mol. Its IUPAC name is 7-[2-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)benzotriazol-5-yl]oxy-7-hydroxyhept-2-en-4-one.
| Compound Name | 7-[2-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)benzotriazol-5-yl]oxy-7-hydroxyhept-2-en-4-one |
|---|---|
| PubChem CID | 57017416 |
| Molecular Formula | C24H29N3O5 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 7-[2-(3-tert-butyl-2-hydroxy-5-methoxyphenyl)benzotriazol-5-yl]oxy-7-hydroxyhept-2-en-4-one |
| SMILES | CC=CC(=O)CCC(O)Oc1ccc2nn(-c3cc(OC)cc(C(C)(C)C)c3O)nc2c1 |
| InChI | InChI=1S/C24H29N3O5/c1-6-7-15(28)8-11-22(29)32-16-9-10-19-20(13-16)26-27(25-19)21-14-17(31-5)12-18(23(21)30)24(2,3)4/h6-7,9-10,12-14,22,29-30H,8,11H2,1-5H3 |
| InChIKey | JDWVQPMVQJKQHV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|