C24H33N3O3Si — CID 177097226
2-tert-butyl-4-[3-[ethenyl(dimethyl)silyl]propoxy]-6-[5-(hydroxymethyl)benzotriazol-2-yl]phenol (PubChem CID 177097226) has the molecular formula C24H33N3O3Si and a molecular weight of 439.63 g/mol. Its IUPAC name is 2-tert-butyl-4-[3-[ethenyl(dimethyl)silyl]propoxy]-6-[5-(hydroxymethyl)benzotriazol-2-yl]phenol.
| Compound Name | 2-tert-butyl-4-[3-[ethenyl(dimethyl)silyl]propoxy]-6-[5-(hydroxymethyl)benzotriazol-2-yl]phenol |
|---|---|
| PubChem CID | 177097226 |
| Molecular Formula | C24H33N3O3Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-tert-butyl-4-[3-[ethenyl(dimethyl)silyl]propoxy]-6-[5-(hydroxymethyl)benzotriazol-2-yl]phenol |
| SMILES | C=C[Si](C)(C)CCCOc1cc(-n2nc3ccc(CO)cc3n2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H33N3O3Si/c1-7-31(5,6)12-8-11-30-18-14-19(24(2,3)4)23(29)22(15-18)27-25-20-10-9-17(16-28)13-21(20)26-27/h7,9-10,13-15,28-29H,1,8,11-12,16H2,2-6H3 |
| InChIKey | OPTCSNIOBDPFAU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|