C15H20O5 — CID 57037088
1-(3,4-dihydroxyphenyl)-5-(4-hydroxybut-2-enoxy)pentan-1-one (PubChem CID 57037088) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-5-(4-hydroxybut-2-enoxy)pentan-1-one.
| Compound Name | 1-(3,4-dihydroxyphenyl)-5-(4-hydroxybut-2-enoxy)pentan-1-one |
|---|---|
| PubChem CID | 57037088 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-5-(4-hydroxybut-2-enoxy)pentan-1-one |
| SMILES | O=C(CCCCOCC=CCO)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C15H20O5/c16-8-2-4-10-20-9-3-1-5-13(17)12-6-7-14(18)15(19)11-12/h2,4,6-7,11,16,18-19H,1,3,5,8-10H2 |
| InChIKey | OSOVYQJSXLDUGT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|