C9H7F12NO — CID 57042289
2,2,3,4,4,4-hexafluoro-N-(2,2,3,4,4,4-hexafluorobutyl)-3-methylbutanamide (PubChem CID 57042289) has the molecular formula C9H7F12NO and a molecular weight of 373.14 g/mol. Its IUPAC name is 2,2,3,4,4,4-hexafluoro-N-(2,2,3,4,4,4-hexafluorobutyl)-3-methylbutanamide.
| Compound Name | 2,2,3,4,4,4-hexafluoro-N-(2,2,3,4,4,4-hexafluorobutyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 57042289 |
| Molecular Formula | C9H7F12NO |
| Molecular Weight | 373.14 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | 2,2,3,4,4,4-hexafluoro-N-(2,2,3,4,4,4-hexafluorobutyl)-3-methylbutanamide |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)C(=O)NCC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F12NO/c1-5(11,9(19,20)21)7(14,15)4(23)22-2-6(12,13)3(10)8(16,17)18/h3H,2H2,1H3,(H,22,23) |
| InChIKey | QDMFGTQFCPBROP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |