C11H19NO3 — CID 57047759
[2-methyl-2-(1,3-oxazolidin-2-yl)propyl] 2-methylprop-2-enoate (PubChem CID 57047759) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is [2-methyl-2-(1,3-oxazolidin-2-yl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-2-(1,3-oxazolidin-2-yl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 57047759 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | [2-methyl-2-(1,3-oxazolidin-2-yl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)C1NCCO1 |
| InChI | InChI=1S/C11H19NO3/c1-8(2)9(13)15-7-11(3,4)10-12-5-6-14-10/h10,12H,1,5-7H2,2-4H3 |
| InChIKey | PMHJNNFHMZTCSF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|