C24H14Cl2O11 — CID 57053994
carboxy 4',5'-dichloro-3',6'-dihydroxy-2',7'-dimethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate (PubChem CID 57053994) has the molecular formula C24H14Cl2O11 and a molecular weight of 549.27 g/mol. Its IUPAC name is carboxy 4',5'-dichloro-3',6'-dihydroxy-2',7'-dimethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate.
| Compound Name | carboxy 4',5'-dichloro-3',6'-dihydroxy-2',7'-dimethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
|---|---|
| PubChem CID | 57053994 |
| Molecular Formula | C24H14Cl2O11 |
| Molecular Weight | 549.27 g/mol |
| Exact Mass | 547.99 |
| IUPAC Name | carboxy 4',5'-dichloro-3',6'-dihydroxy-2',7'-dimethoxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxylate |
| SMILES | COc1cc2c(c(Cl)c1O)Oc1c(cc(OC)c(O)c1Cl)C21OC(=O)c2cc(C(=O)OC(=O)O)ccc21 |
| InChI | InChI=1S/C24H14Cl2O11/c1-33-13-6-11-19(15(25)17(13)27)35-20-12(7-14(34-2)18(28)16(20)26)24(11)10-4-3-8(21(29)36-23(31)32)5-9(10)22(30)37-24/h3-7,27-28H,1-2H3,(H,31,32) |
| InChIKey | IEPAETPWTKGPQN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|