C28H17Cl4NO8 — CID 138492619
(2,5-dioxopyrrolidin-1-yl) 1',3',6',8'-tetrachloro-2',7'-dihydroxy-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxylate (PubChem CID 138492619) has the molecular formula C28H17Cl4NO8 and a molecular weight of 637.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1',3',6',8'-tetrachloro-2',7'-dihydroxy-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1',3',6',8'-tetrachloro-2',7'-dihydroxy-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxylate |
|---|---|
| PubChem CID | 138492619 |
| Molecular Formula | C28H17Cl4NO8 |
| Molecular Weight | 637.26 g/mol |
| Exact Mass | 634.97 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1',3',6',8'-tetrachloro-2',7'-dihydroxy-9',9'-dimethyl-1-oxospiro[2-benzofuran-3,10'-anthracene]-5-carboxylate |
| SMILES | CC1(C)c2c(cc(Cl)c(O)c2Cl)C2(OC(=O)c3ccc(C(=O)ON4C(=O)CCC4=O)cc32)c2cc(Cl)c(O)c(Cl)c21 |
| InChI | InChI=1S/C28H17Cl4NO8/c1-27(2)19-13(8-15(29)23(36)21(19)31)28(14-9-16(30)24(37)22(32)20(14)27)12-7-10(3-4-11(12)26(39)40-28)25(38)41-33-17(34)5-6-18(33)35/h3-4,7-9,36-37H,5-6H2,1-2H3 |
| InChIKey | OVMVRGWSRGLTOL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.26 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|