C16H12N4O — CID 57063487
5-(pyrido[2,3-d]pyrimidin-4-ylmethyl)-1H-indol-2-ol (PubChem CID 57063487) has the molecular formula C16H12N4O and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(pyrido[2,3-d]pyrimidin-4-ylmethyl)-1H-indol-2-ol.
| Compound Name | 5-(pyrido[2,3-d]pyrimidin-4-ylmethyl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 57063487 |
| Molecular Formula | C16H12N4O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5-(pyrido[2,3-d]pyrimidin-4-ylmethyl)-1H-indol-2-ol |
| SMILES | Oc1cc2cc(Cc3ncnc4ncccc34)ccc2[nH]1 |
| InChI | InChI=1S/C16H12N4O/c21-15-8-11-6-10(3-4-13(11)20-15)7-14-12-2-1-5-17-16(12)19-9-18-14/h1-6,8-9,20-21H,7H2 |
| InChIKey | FUGGPPZEOGGFTC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |