C8H8ClNO — CID 57068705
3-chloro-5,6-dihydro-4aH-cyclopenta[b]pyran-4-imine (PubChem CID 57068705) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is 3-chloro-5,6-dihydro-4aH-cyclopenta[b]pyran-4-imine.
| Compound Name | 3-chloro-5,6-dihydro-4aH-cyclopenta[b]pyran-4-imine |
|---|---|
| PubChem CID | 57068705 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 3-chloro-5,6-dihydro-4aH-cyclopenta[b]pyran-4-imine |
| SMILES | [H]/N=C1\C(Cl)=COC2=CCCC21 |
| InChI | InChI=1S/C8H8ClNO/c9-6-4-11-7-3-1-2-5(7)8(6)10/h3-5,10H,1-2H2/b10-8- |
| InChIKey | ZMGUQNGUVHGVGK-NTMALXAHSA-N |
| XLogP | 2.41 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|