C14H32N4O6S — CID 57076759
[(2R)-2-amino-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl] hydrogen sulfate (PubChem CID 57076759) has the molecular formula C14H32N4O6S and a molecular weight of 384.50 g/mol. Its IUPAC name is [(2R)-2-amino-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl] hydrogen sulfate.
| Compound Name | [(2R)-2-amino-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 57076759 |
| Molecular Formula | C14H32N4O6S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(2R)-2-amino-1,1-dibutoxy-5-(diaminomethylideneamino)pentan-2-yl] hydrogen sulfate |
| SMILES | CCCCOC(OCCCC)[C@@](N)(CCCN=C(N)N)OS(=O)(=O)O |
| InChI | InChI=1S/C14H32N4O6S/c1-3-5-10-22-12(23-11-6-4-2)14(17,24-25(19,20)21)8-7-9-18-13(15)16/h12H,3-11,17H2,1-2H3,(H4,15,16,18)(H,19,20,21)/t14-/m1/s1 |
| InChIKey | GKUZAGQTMNMELU-CQSZACIVSA-N |
| XLogP | 0.47 |
| TPSA | 172.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|