C7H16N4O2 — CID 118056218
2-[3-[(1R)-1-amino-2-oxopropoxy]propyl]guanidine (PubChem CID 118056218) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[3-[(1R)-1-amino-2-oxopropoxy]propyl]guanidine.
| Compound Name | 2-[3-[(1R)-1-amino-2-oxopropoxy]propyl]guanidine |
|---|---|
| PubChem CID | 118056218 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[3-[(1R)-1-amino-2-oxopropoxy]propyl]guanidine |
| SMILES | CC(=O)[C@H](N)OCCCN=C(N)N |
| InChI | InChI=1S/C7H16N4O2/c1-5(12)6(8)13-4-2-3-11-7(9)10/h6H,2-4,8H2,1H3,(H4,9,10,11)/t6-/m1/s1 |
| InChIKey | CIOZMYFKBSPIRL-ZCFIWIBFSA-N |
| XLogP | -1.46 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|