C19H15N3S3 — CID 57083497
4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methylsulfanyl]thiophene-2-carboximidamide (PubChem CID 57083497) has the molecular formula C19H15N3S3 and a molecular weight of 381.55 g/mol. Its IUPAC name is 4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methylsulfanyl]thiophene-2-carboximidamide.
| Compound Name | 4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methylsulfanyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 57083497 |
| Molecular Formula | C19H15N3S3 |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4-[(4-naphthalen-2-yl-1,3-thiazol-2-yl)methylsulfanyl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(SCc2nc(-c3ccc4ccccc4c3)cs2)cs1 |
| InChI | InChI=1S/C19H15N3S3/c20-19(21)17-8-15(9-24-17)23-11-18-22-16(10-25-18)14-6-5-12-3-1-2-4-13(12)7-14/h1-10H,11H2,(H3,20,21) |
| InChIKey | DGKFOVBRRPWEPL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 62.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|