C31H37N5O7Si — CID 57093051
N-[1-benzoyl-9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxopurin-2-yl]benzamide (PubChem CID 57093051) has the molecular formula C31H37N5O7Si and a molecular weight of 619.75 g/mol. Its IUPAC name is N-[1-benzoyl-9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxopurin-2-yl]benzamide.
| Compound Name | N-[1-benzoyl-9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxopurin-2-yl]benzamide |
|---|---|
| PubChem CID | 57093051 |
| Molecular Formula | C31H37N5O7Si |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | N-[1-benzoyl-9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5,5-bis(hydroxymethyl)oxolan-2-yl]-6-oxopurin-2-yl]benzamide |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@H](n2cnc3c(=O)n(C(=O)c4ccccc4)c(NC(=O)c4ccccc4)nc32)OC1(CO)CO |
| InChI | InChI=1S/C31H37N5O7Si/c1-30(2,3)44(4,5)43-22-16-23(42-31(22,17-37)18-38)35-19-32-24-25(35)33-29(34-26(39)20-12-8-6-9-13-20)36(28(24)41)27(40)21-14-10-7-11-15-21/h6-15,19,22-23,37-38H,16-18H2,1-5H3,(H,33,34,39)/t22-,23+/m0/s1 |
| InChIKey | CTRPNIRRLJBADR-XZOQPEGZSA-N |
| XLogP | 3.57 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|