C32H39N5O6Si — CID 10651483
methyl (2R,3S,5S)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)oxolane-2-carboxylate (PubChem CID 10651483) has the molecular formula C32H39N5O6Si and a molecular weight of 617.78 g/mol. Its IUPAC name is methyl (2R,3S,5S)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)oxolane-2-carboxylate.
| Compound Name | methyl (2R,3S,5S)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)oxolane-2-carboxylate |
|---|---|
| PubChem CID | 10651483 |
| Molecular Formula | C32H39N5O6Si |
| Molecular Weight | 617.78 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | methyl (2R,3S,5S)-5-(6-benzamidopurin-9-yl)-3-[tert-butyl(dimethyl)silyl]oxy-2-(phenylmethoxymethyl)oxolane-2-carboxylate |
| SMILES | COC(=O)[C@]1(COCc2ccccc2)O[C@H](n2cnc3c(NC(=O)c4ccccc4)ncnc32)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H39N5O6Si/c1-31(2,3)44(5,6)43-24-17-25(42-32(24,30(39)40-4)19-41-18-22-13-9-7-10-14-22)37-21-35-26-27(33-20-34-28(26)37)36-29(38)23-15-11-8-12-16-23/h7-16,20-21,24-25H,17-19H2,1-6H3,(H,33,34,36,38)/t24-,25-,32+/m0/s1 |
| InChIKey | HWBBODOLSBCCAV-PNRGXICFSA-N |
| XLogP | 5.52 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.78 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|