C21H16F3NO2 — CID 57097284
2-[6-methoxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylidene]inden-1-yl]acetonitrile (PubChem CID 57097284) has the molecular formula C21H16F3NO2 and a molecular weight of 371.36 g/mol. Its IUPAC name is 2-[6-methoxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylidene]inden-1-yl]acetonitrile.
| Compound Name | 2-[6-methoxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylidene]inden-1-yl]acetonitrile |
|---|---|
| PubChem CID | 57097284 |
| Molecular Formula | C21H16F3NO2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 2-[6-methoxy-2-methyl-3-[[4-(trifluoromethoxy)phenyl]methylidene]inden-1-yl]acetonitrile |
| SMILES | COc1ccc2c(c1)C(CC#N)=C(C)C2=Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F3NO2/c1-13-17(9-10-25)20-12-16(26-2)7-8-18(20)19(13)11-14-3-5-15(6-4-14)27-21(22,23)24/h3-8,11-12H,9H2,1-2H3 |
| InChIKey | FIMNASDFJMOWIG-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|