C18H20O7S — CID 57123947
2-hydroxy-4-[1-(3-methylphenyl)sulfonyloxybutan-2-yloxy]benzoic acid (PubChem CID 57123947) has the molecular formula C18H20O7S and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-hydroxy-4-[1-(3-methylphenyl)sulfonyloxybutan-2-yloxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[1-(3-methylphenyl)sulfonyloxybutan-2-yloxy]benzoic acid |
|---|---|
| PubChem CID | 57123947 |
| Molecular Formula | C18H20O7S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-hydroxy-4-[1-(3-methylphenyl)sulfonyloxybutan-2-yloxy]benzoic acid |
| SMILES | CCC(COS(=O)(=O)c1cccc(C)c1)Oc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C18H20O7S/c1-3-13(25-14-7-8-16(18(20)21)17(19)10-14)11-24-26(22,23)15-6-4-5-12(2)9-15/h4-10,13,19H,3,11H2,1-2H3,(H,20,21) |
| InChIKey | PXIOFNSKLBBYFP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|