About 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine
4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 57124146) has the molecular formula C6H6N4S2
and a molecular weight of 198.28 g/mol. Its IUPAC name is 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine.
Analyze 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine (CID 57124146) is 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine is Nc1nc(Cc2cnsn2)cs1.
What is the InChIKey of 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine?
The InChIKey is WNMJMFPLRBLJCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4S2/c7-6-9-5(3-11-6)1-4-2-8-12-10-4/h2-3H,1H2,(H2,7,9).
What are the key properties of 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine?
4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine has a molecular weight of 198.28 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,2,5-thiadiazol-3-ylmethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 57124146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).