C15H23F2N2O+ — CID 57132973
1-[3-(3,4-difluorophenoxy)propyl]-4-methylpiperidin-1-ium-1-amine (PubChem CID 57132973) has the molecular formula C15H23F2N2O+ and a molecular weight of 285.36 g/mol. Its IUPAC name is 1-[3-(3,4-difluorophenoxy)propyl]-4-methylpiperidin-1-ium-1-amine.
| Compound Name | 1-[3-(3,4-difluorophenoxy)propyl]-4-methylpiperidin-1-ium-1-amine |
|---|---|
| PubChem CID | 57132973 |
| Molecular Formula | C15H23F2N2O+ |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | 1-[3-(3,4-difluorophenoxy)propyl]-4-methylpiperidin-1-ium-1-amine |
| SMILES | CC1CC[N+](N)(CCCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C15H23F2N2O/c1-12-5-8-19(18,9-6-12)7-2-10-20-13-3-4-14(16)15(17)11-13/h3-4,11-12H,2,5-10,18H2,1H3/q+1 |
| InChIKey | KRNPMXPRFBNJRI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|