C27H50O2Si — CID 57139542
(8R)-8-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]-2-methylnona-3,5-dien-2-ol (PubChem CID 57139542) has the molecular formula C27H50O2Si and a molecular weight of 434.78 g/mol. Its IUPAC name is (8R)-8-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]-2-methylnona-3,5-dien-2-ol.
| Compound Name | (8R)-8-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]-2-methylnona-3,5-dien-2-ol |
|---|---|
| PubChem CID | 57139542 |
| Molecular Formula | C27H50O2Si |
| Molecular Weight | 434.78 g/mol |
| Exact Mass | 434.36 |
| IUPAC Name | (8R)-8-[(1R,4aR,5S,8aR)-5-[tert-butyl(dimethyl)silyl]oxy-8a-methyl-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-yl]-2-methylnona-3,5-dien-2-ol |
| SMILES | C[C@H](CC=CC=CC(C)(C)O)[C@H]1CCC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C27H50O2Si/c1-21(15-11-10-12-19-26(5,6)28)22-16-13-17-23-24(18-14-20-27(22,23)7)29-30(8,9)25(2,3)4/h10-12,19,21-24,28H,13-18,20H2,1-9H3/t21-,22-,23+,24+,27-/m1/s1 |
| InChIKey | FEQNMCJKSMQHHP-PXYUTCIWSA-N |
| XLogP | 7.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.78 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|