C28H26ClN8O2S+ — CID 57141271
1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[2-(5-chlorothiophen-2-yl)acetyl]piperazin-1-ium-2-one (PubChem CID 57141271) has the molecular formula C28H26ClN8O2S+ and a molecular weight of 574.09 g/mol. Its IUPAC name is 1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[2-(5-chlorothiophen-2-yl)acetyl]piperazin-1-ium-2-one.
| Compound Name | 1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[2-(5-chlorothiophen-2-yl)acetyl]piperazin-1-ium-2-one |
|---|---|
| PubChem CID | 57141271 |
| Molecular Formula | C28H26ClN8O2S+ |
| Molecular Weight | 574.09 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 1,1-bis[(4-aminoquinazolin-7-yl)methyl]-4-[2-(5-chlorothiophen-2-yl)acetyl]piperazin-1-ium-2-one |
| SMILES | Nc1ncnc2cc(C[N+]3(Cc4ccc5c(N)ncnc5c4)CCN(C(=O)Cc4ccc(Cl)s4)CC3=O)ccc12 |
| InChI | InChI=1S/C28H26ClN8O2S/c29-24-6-3-19(40-24)11-25(38)36-7-8-37(26(39)12-36,13-17-1-4-20-22(9-17)32-15-34-27(20)30)14-18-2-5-21-23(10-18)33-16-35-28(21)31/h1-6,9-10,15-16H,7-8,11-14H2,(H2,30,32,34)(H2,31,33,35)/q+1 |
| InChIKey | HMTRWCWOYANGNR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.09 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|