C6H3Cl7O4 — CID 57149068
2,2,2-trichloroethyl 2-carbonochloridoyloxy-3,3,3-trichloro-2-deuteriopropanoate (PubChem CID 57149068) has the molecular formula C6H3Cl7O4 and a molecular weight of 388.26 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-carbonochloridoyloxy-3,3,3-trichloro-2-deuteriopropanoate.
| Compound Name | 2,2,2-trichloroethyl 2-carbonochloridoyloxy-3,3,3-trichloro-2-deuteriopropanoate |
|---|---|
| PubChem CID | 57149068 |
| Molecular Formula | C6H3Cl7O4 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 384.79 |
| IUPAC Name | 2,2,2-trichloroethyl 2-carbonochloridoyloxy-3,3,3-trichloro-2-deuteriopropanoate |
| SMILES | [2H]C(OC(=O)Cl)(C(=O)OCC(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H3Cl7O4/c7-4(15)17-2(6(11,12)13)3(14)16-1-5(8,9)10/h2H,1H2/i2D |
| InChIKey | BJIZIBRXXJVKFO-VMNATFBRSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|