C25H31NO2 — CID 57158875
1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-4-phenylbut-3-en-1-one (PubChem CID 57158875) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-4-phenylbut-3-en-1-one.
| Compound Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-4-phenylbut-3-en-1-one |
|---|---|
| PubChem CID | 57158875 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]-4-phenylbut-3-en-1-one |
| SMILES | CN(C)Cc1ccc(C2CCC(O)C(C(=O)CC=Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C25H31NO2/c1-26(2)18-20-11-13-21(14-12-20)22-15-16-25(28)23(17-22)24(27)10-6-9-19-7-4-3-5-8-19/h3-9,11-14,22-23,25,28H,10,15-18H2,1-2H3 |
| InChIKey | WYNHJRZRTZYXPQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |